C38H50N4O3 — CID 175897025
4-[2-[4-[[4-(2-methoxyethoxy)phenyl]methyl]-2-(2-propan-2-ylphenyl)piperazin-1-yl]-7-azaspiro[3.5]nonan-7-yl]benzamide (PubChem CID 175897025) has the molecular formula C38H50N4O3 and a molecular weight of 610.84 g/mol. Its IUPAC name is 4-[2-[4-[[4-(2-methoxyethoxy)phenyl]methyl]-2-(2-propan-2-ylphenyl)piperazin-1-yl]-7-azaspiro[3.5]nonan-7-yl]benzamide.
| Compound Name | 4-[2-[4-[[4-(2-methoxyethoxy)phenyl]methyl]-2-(2-propan-2-ylphenyl)piperazin-1-yl]-7-azaspiro[3.5]nonan-7-yl]benzamide |
|---|---|
| PubChem CID | 175897025 |
| Molecular Formula | C38H50N4O3 |
| Molecular Weight | 610.84 g/mol |
| Exact Mass | 610.39 |
| IUPAC Name | 4-[2-[4-[[4-(2-methoxyethoxy)phenyl]methyl]-2-(2-propan-2-ylphenyl)piperazin-1-yl]-7-azaspiro[3.5]nonan-7-yl]benzamide |
| SMILES | COCCOc1ccc(CN2CCN(C3CC4(CCN(c5ccc(C(N)=O)cc5)CC4)C3)C(c3ccccc3C(C)C)C2)cc1 |
| InChI | InChI=1S/C38H50N4O3/c1-28(2)34-6-4-5-7-35(34)36-27-40(26-29-8-14-33(15-9-29)45-23-22-44-3)20-21-42(36)32-24-38(25-32)16-18-41(19-17-38)31-12-10-30(11-13-31)37(39)43/h4-15,28,32,36H,16-27H2,1-3H3,(H2,39,43) |
| InChIKey | XXRWFNBKCGDEKC-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 71.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.84 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|