C23H30ClFN4 — CID 175897614
6-chloro-2-[3-(dimethylamino)azetidin-1-yl]-8-fluoro-4-octan-3-ylquinoline-3-carbonitrile (PubChem CID 175897614) has the molecular formula C23H30ClFN4 and a molecular weight of 416.97 g/mol. Its IUPAC name is 6-chloro-2-[3-(dimethylamino)azetidin-1-yl]-8-fluoro-4-octan-3-ylquinoline-3-carbonitrile.
| Compound Name | 6-chloro-2-[3-(dimethylamino)azetidin-1-yl]-8-fluoro-4-octan-3-ylquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 175897614 |
| Molecular Formula | C23H30ClFN4 |
| Molecular Weight | 416.97 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 6-chloro-2-[3-(dimethylamino)azetidin-1-yl]-8-fluoro-4-octan-3-ylquinoline-3-carbonitrile |
| SMILES | CCCCCC(CC)c1c(C#N)c(N2CC(N(C)C)C2)nc2c(F)cc(Cl)cc12 |
| InChI | InChI=1S/C23H30ClFN4/c1-5-7-8-9-15(6-2)21-18-10-16(24)11-20(25)22(18)27-23(19(21)12-26)29-13-17(14-29)28(3)4/h10-11,15,17H,5-9,13-14H2,1-4H3 |
| InChIKey | WTASBCJGJKCRQL-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 43.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.97 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|