C54H49Cl2N2PRu+2 — CID 175897774
[4-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-2,3-dichlorocyclohexa-1,5-dien-1-yl]-diphenyl-(3-phenylinden-1-ylidene)-λ5-phosphane;ruthenium(2+) (PubChem CID 175897774) has the molecular formula C54H49Cl2N2PRu+2 and a molecular weight of 928.95 g/mol. Its IUPAC name is [4-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-2,3-dichlorocyclohexa-1,5-dien-1-yl]-diphenyl-(3-phenylinden-1-ylidene)-λ5-phosphane;ruthenium(2+).
| Compound Name | [4-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-2,3-dichlorocyclohexa-1,5-dien-1-yl]-diphenyl-(3-phenylinden-1-ylidene)-λ5-phosphane;ruthenium(2+) |
|---|---|
| PubChem CID | 175897774 |
| Molecular Formula | C54H49Cl2N2PRu+2 |
| Molecular Weight | 928.95 g/mol |
| Exact Mass | 928.20 |
| IUPAC Name | [4-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-2,3-dichlorocyclohexa-1,5-dien-1-yl]-diphenyl-(3-phenylinden-1-ylidene)-λ5-phosphane;ruthenium(2+) |
| SMILES | Cc1cc(C)c(N2CCN(c3c(C)cc(C)cc3C)C2=C2C=CC(P(=C3C=C(c4ccccc4)c4ccccc43)(c3ccccc3)c3ccccc3)=C(Cl)C2Cl)c(C)c1.[Ru+2] |
| InChI | InChI=1S/C54H49Cl2N2P.Ru/c1-35-30-37(3)52(38(4)31-35)57-28-29-58(53-39(5)32-36(2)33-40(53)6)54(57)46-26-27-48(51(56)50(46)55)59(42-20-12-8-13-21-42,43-22-14-9-15-23-43)49-34-47(41-18-10-7-11-19-41)44-24-16-17-25-45(44)49;/h7-27,30-34,50H,28-29H2,1-6H3;/q;+2 |
| InChIKey | FCWBYBDQFSFTNS-UHFFFAOYSA-N |
| XLogP | 13.04 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 928.95 |
| LogP ≤ 5 | 13.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|