C32H31N7O4 — CID 175898915
(2S,11S)-11-[acetyl-[(2,2-diphenylacetyl)amino]amino]-12-oxo-N-(2H-triazol-4-ylmethyl)-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide (PubChem CID 175898915) has the molecular formula C32H31N7O4 and a molecular weight of 577.65 g/mol. Its IUPAC name is (2S,11S)-11-[acetyl-[(2,2-diphenylacetyl)amino]amino]-12-oxo-N-(2H-triazol-4-ylmethyl)-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide.
| Compound Name | (2S,11S)-11-[acetyl-[(2,2-diphenylacetyl)amino]amino]-12-oxo-N-(2H-triazol-4-ylmethyl)-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide |
|---|---|
| PubChem CID | 175898915 |
| Molecular Formula | C32H31N7O4 |
| Molecular Weight | 577.65 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | (2S,11S)-11-[acetyl-[(2,2-diphenylacetyl)amino]amino]-12-oxo-N-(2H-triazol-4-ylmethyl)-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide |
| SMILES | CC(=O)N(NC(=O)C(c1ccccc1)c1ccccc1)[C@H]1CCc2cccc3c2N(C1=O)[C@H](C(=O)NCc1cn[nH]n1)C3 |
| InChI | InChI=1S/C32H31N7O4/c1-20(40)39(36-31(42)28(21-9-4-2-5-10-21)22-11-6-3-7-12-22)26-16-15-23-13-8-14-24-17-27(38(29(23)24)32(26)43)30(41)33-18-25-19-34-37-35-25/h2-14,19,26-28H,15-18H2,1H3,(H,33,41)(H,36,42)(H,34,35,37)/t26-,27-/m0/s1 |
| InChIKey | PQQLHQNQUOVWBV-SVBPBHIXSA-N |
| XLogP | 2.41 |
| TPSA | 140.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.65 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|