C14H23F5OS — CID 175898942
1-(4,4,5,5,5-pentafluoropentylsulfinyl)non-1-ene (PubChem CID 175898942) has the molecular formula C14H23F5OS and a molecular weight of 334.39 g/mol. Its IUPAC name is 1-(4,4,5,5,5-pentafluoropentylsulfinyl)non-1-ene.
| Compound Name | 1-(4,4,5,5,5-pentafluoropentylsulfinyl)non-1-ene |
|---|---|
| PubChem CID | 175898942 |
| Molecular Formula | C14H23F5OS |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1-(4,4,5,5,5-pentafluoropentylsulfinyl)non-1-ene |
| SMILES | CCCCCCCC=CS(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H23F5OS/c1-2-3-4-5-6-7-8-11-21(20)12-9-10-13(15,16)14(17,18)19/h8,11H,2-7,9-10,12H2,1H3 |
| InChIKey | VDYJBVHHSWKRNK-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|