About (5S)-5-[(4H-pyrido[1,2-a]pyrimidin-7-ylmethylamino)methyl]pyrrolidin-2-one
(5S)-5-[(4H-pyrido[1,2-a]pyrimidin-7-ylmethylamino)methyl]pyrrolidin-2-one (PubChem CID 175900169) has the molecular formula C14H18N4O
and a molecular weight of 258.32 g/mol. Its IUPAC name is (5S)-5-[(4H-pyrido[1,2-a]pyrimidin-7-ylmethylamino)methyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | (5S)-5-[(4H-pyrido[1,2-a]pyrimidin-7-ylmethylamino)methyl]pyrrolidin-2-one |
| PubChem CID | 175900169 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (5S)-5-[(4H-pyrido[1,2-a]pyrimidin-7-ylmethylamino)methyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@@H](CNCC2=CN3CC=CN=C3C=C2)N1 |
| InChI | InChI=1S/C14H18N4O/c19-14-5-3-12(17-14)9-15-8-11-2-4-13-16-6-1-7-18(13)10-11/h1-2,4,6,10,12,15H,3,5,7-9H2,(H,17,19)/t12-/m0/s1 |
| InChIKey | JLKAIWIBPDDFAA-LBPRGKRZSA-N |
| XLogP | 0.54 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5S)-5-[(4H-pyrido[1,2-a]pyrimidin-7-ylmethylamino)methyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-[(4H-pyrido[1,2-a]pyrimidin-7-ylmethylamino)methyl]pyrrolidin-2-one?
The IUPAC name of (5S)-5-[(4H-pyrido[1,2-a]pyrimidin-7-ylmethylamino)methyl]pyrrolidin-2-one (CID 175900169) is (5S)-5-[(4H-pyrido[1,2-a]pyrimidin-7-ylmethylamino)methyl]pyrrolidin-2-one.
What is the SMILES notation for (5S)-5-[(4H-pyrido[1,2-a]pyrimidin-7-ylmethylamino)methyl]pyrrolidin-2-one?
The canonical SMILES for (5S)-5-[(4H-pyrido[1,2-a]pyrimidin-7-ylmethylamino)methyl]pyrrolidin-2-one is O=C1CC[C@@H](CNCC2=CN3CC=CN=C3C=C2)N1.
What is the InChIKey of (5S)-5-[(4H-pyrido[1,2-a]pyrimidin-7-ylmethylamino)methyl]pyrrolidin-2-one?
The InChIKey is JLKAIWIBPDDFAA-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H18N4O/c19-14-5-3-12(17-14)9-15-8-11-2-4-13-16-6-1-7-18(13)10-11/h1-2,4,6,10,12,15H,3,5,7-9H2,(H,17,19)/t12-/m0/s1.
What are the key properties of (5S)-5-[(4H-pyrido[1,2-a]pyrimidin-7-ylmethylamino)methyl]pyrrolidin-2-one?
(5S)-5-[(4H-pyrido[1,2-a]pyrimidin-7-ylmethylamino)methyl]pyrrolidin-2-one has a molecular weight of 258.32 g/mol, XLogP of 0.54, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-[(4H-pyrido[1,2-a]pyrimidin-7-ylmethylamino)methyl]pyrrolidin-2-one is sourced from PubChem (CID 175900169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).