C8H9N3 — CID 175900224
8,8-dideuterio-1,3,5-triazacycloundeca-2,4,6,9,11-pentaene (PubChem CID 175900224) has the molecular formula C8H9N3 and a molecular weight of 149.19 g/mol. Its IUPAC name is 8,8-dideuterio-1,3,5-triazacycloundeca-2,4,6,9,11-pentaene.
| Compound Name | 8,8-dideuterio-1,3,5-triazacycloundeca-2,4,6,9,11-pentaene |
|---|---|
| PubChem CID | 175900224 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.09 |
| IUPAC Name | 8,8-dideuterio-1,3,5-triazacycloundeca-2,4,6,9,11-pentaene |
| SMILES | [2H]C1([2H])C=C/C=N\C=N/C=N\C=C1 |
| InChI | InChI=1S/C8H9N3/c1-2-4-6-10-8-11-7-9-5-3-1/h1,3-8H,2H2/b3-1?,6-4?,9-5-,10-8-,11-7-/i2D2 |
| InChIKey | FCXPCEHFNACTFJ-WKKUEBGCSA-N |
| XLogP | 1.59 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |