C28H46O3Si — CID 175900492
butyl 2-dimethylsilyloxydocosa-4,7,11,13,15,19-hexaenoate (PubChem CID 175900492) has the molecular formula C28H46O3Si and a molecular weight of 458.76 g/mol. Its IUPAC name is butyl 2-dimethylsilyloxydocosa-4,7,11,13,15,19-hexaenoate.
| Compound Name | butyl 2-dimethylsilyloxydocosa-4,7,11,13,15,19-hexaenoate |
|---|---|
| PubChem CID | 175900492 |
| Molecular Formula | C28H46O3Si |
| Molecular Weight | 458.76 g/mol |
| Exact Mass | 458.32 |
| IUPAC Name | butyl 2-dimethylsilyloxydocosa-4,7,11,13,15,19-hexaenoate |
| SMILES | CCC=CCCC=CC=CC=CCCC=CCC=CCC(O[SiH](C)C)C(=O)OCCCC |
| InChI | InChI=1S/C28H46O3Si/c1-5-7-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-27(31-32(3)4)28(29)30-26-8-6-2/h7,9,12-17,20-21,23-24,27,32H,5-6,8,10-11,18-19,22,25-26H2,1-4H3 |
| InChIKey | WEHUZOHFJMGDDT-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.76 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|