C22H25FN6O — CID 175900649
N-[2-[[8-(2,2-dimethylpropylamino)-6-methylpyrido[3,4-d]pyrimidin-2-yl]amino]-6-fluorophenyl]prop-2-enamide (PubChem CID 175900649) has the molecular formula C22H25FN6O and a molecular weight of 408.48 g/mol. Its IUPAC name is N-[2-[[8-(2,2-dimethylpropylamino)-6-methylpyrido[3,4-d]pyrimidin-2-yl]amino]-6-fluorophenyl]prop-2-enamide.
| Compound Name | N-[2-[[8-(2,2-dimethylpropylamino)-6-methylpyrido[3,4-d]pyrimidin-2-yl]amino]-6-fluorophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 175900649 |
| Molecular Formula | C22H25FN6O |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | N-[2-[[8-(2,2-dimethylpropylamino)-6-methylpyrido[3,4-d]pyrimidin-2-yl]amino]-6-fluorophenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1c(F)cccc1Nc1ncc2cc(C)nc(NCC(C)(C)C)c2n1 |
| InChI | InChI=1S/C22H25FN6O/c1-6-17(30)28-19-15(23)8-7-9-16(19)27-21-24-11-14-10-13(2)26-20(18(14)29-21)25-12-22(3,4)5/h6-11H,1,12H2,2-5H3,(H,25,26)(H,28,30)(H,24,27,29) |
| InChIKey | WZDYMJILRLSEQN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|