C19H26F9N7O6 — CID 175900985
4-[1,3-bis(3-aminopropyl)imidazol-1-ium-2-yl]-1-methylpyrazol-5-amine;2,2,2-trifluoroacetate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 175900985) has the molecular formula C19H26F9N7O6 and a molecular weight of 619.44 g/mol. Its IUPAC name is 4-[1,3-bis(3-aminopropyl)imidazol-1-ium-2-yl]-1-methylpyrazol-5-amine;2,2,2-trifluoroacetate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[1,3-bis(3-aminopropyl)imidazol-1-ium-2-yl]-1-methylpyrazol-5-amine;2,2,2-trifluoroacetate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 175900985 |
| Molecular Formula | C19H26F9N7O6 |
| Molecular Weight | 619.44 g/mol |
| Exact Mass | 619.18 |
| IUPAC Name | 4-[1,3-bis(3-aminopropyl)imidazol-1-ium-2-yl]-1-methylpyrazol-5-amine;2,2,2-trifluoroacetate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cn1ncc(-c2n(CCCN)cc[n+]2CCCN)c1N.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C13H23N7.3C2HF3O2/c1-18-12(16)11(10-17-18)13-19(6-2-4-14)8-9-20(13)7-3-5-15;3*3-2(4,5)1(6)7/h8-10,16H,2-7,14-15H2,1H3;3*(H,6,7) |
| InChIKey | MOIKJGREYOAUSF-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 219.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.44 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|