C12H23BO4 — CID 175901557
[(1S,2R,3R)-2-(hydroxymethyl)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]methanol (PubChem CID 175901557) has the molecular formula C12H23BO4 and a molecular weight of 242.12 g/mol. Its IUPAC name is [(1S,2R,3R)-2-(hydroxymethyl)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]methanol.
| Compound Name | [(1S,2R,3R)-2-(hydroxymethyl)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]methanol |
|---|---|
| PubChem CID | 175901557 |
| Molecular Formula | C12H23BO4 |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | [(1S,2R,3R)-2-(hydroxymethyl)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]methanol |
| SMILES | CC1(C)OB([C@@H]2[C@H](CO)[C@]2(C)CO)OC1(C)C |
| InChI | InChI=1S/C12H23BO4/c1-10(2)11(3,4)17-13(16-10)9-8(6-14)12(9,5)7-15/h8-9,14-15H,6-7H2,1-5H3/t8-,9+,12-/m0/s1 |
| InChIKey | QPBWNRFQPYGIGY-SBMIAAHKSA-N |
| XLogP | 1.07 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|