C10H22N2 — CID 175901768
2-(3-methylbutyl)-1,4-diazepane (PubChem CID 175901768) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is 2-(3-methylbutyl)-1,4-diazepane.
| Compound Name | 2-(3-methylbutyl)-1,4-diazepane |
|---|---|
| PubChem CID | 175901768 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 2-(3-methylbutyl)-1,4-diazepane |
| SMILES | CC(C)CCC1CNCCCN1 |
| InChI | InChI=1S/C10H22N2/c1-9(2)4-5-10-8-11-6-3-7-12-10/h9-12H,3-8H2,1-2H3 |
| InChIKey | LRZMLMTYTHLXPP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |