C20H20N8 — CID 175902287
9-methyl-2-(2-piperidin-3-ylpyrimidin-4-yl)-8-pyridin-4-ylpurine (PubChem CID 175902287) has the molecular formula C20H20N8 and a molecular weight of 372.44 g/mol. Its IUPAC name is 9-methyl-2-(2-piperidin-3-ylpyrimidin-4-yl)-8-pyridin-4-ylpurine.
| Compound Name | 9-methyl-2-(2-piperidin-3-ylpyrimidin-4-yl)-8-pyridin-4-ylpurine |
|---|---|
| PubChem CID | 175902287 |
| Molecular Formula | C20H20N8 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 9-methyl-2-(2-piperidin-3-ylpyrimidin-4-yl)-8-pyridin-4-ylpurine |
| SMILES | Cn1c(-c2ccncc2)nc2cnc(-c3ccnc(C4CCCNC4)n3)nc21 |
| InChI | InChI=1S/C20H20N8/c1-28-19(13-4-8-21-9-5-13)26-16-12-24-18(27-20(16)28)15-6-10-23-17(25-15)14-3-2-7-22-11-14/h4-6,8-10,12,14,22H,2-3,7,11H2,1H3 |
| InChIKey | UHWRQSHGVKHWIZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |