About [1,3-bis(tritylsulfanyl)propan-2-yloxycarbonylamino] 2-methylprop-2-enoate
[1,3-bis(tritylsulfanyl)propan-2-yloxycarbonylamino] 2-methylprop-2-enoate (PubChem CID 175903234) has the molecular formula C46H41NO4S2
and a molecular weight of 735.97 g/mol. Its IUPAC name is [1,3-bis(tritylsulfanyl)propan-2-yloxycarbonylamino] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [1,3-bis(tritylsulfanyl)propan-2-yloxycarbonylamino] 2-methylprop-2-enoate |
| PubChem CID | 175903234 |
| Molecular Formula | C46H41NO4S2 |
| Molecular Weight | 735.97 g/mol |
| Exact Mass | 735.25 |
| IUPAC Name | [1,3-bis(tritylsulfanyl)propan-2-yloxycarbonylamino] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)ONC(=O)OC(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)CSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C46H41NO4S2/c1-35(2)43(48)51-47-44(49)50-42(33-52-45(36-21-9-3-10-22-36,37-23-11-4-12-24-37)38-25-13-5-14-26-38)34-53-46(39-27-15-6-16-28-39,40-29-17-7-18-30-40)41-31-19-8-20-32-41/h3-32,42H,1,33-34H2,2H3,(H,47,49) |
| InChIKey | HZSZLOYKPMLKSM-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 735.97 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze [1,3-bis(tritylsulfanyl)propan-2-yloxycarbonylamino] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3-bis(tritylsulfanyl)propan-2-yloxycarbonylamino] 2-methylprop-2-enoate?
The IUPAC name of [1,3-bis(tritylsulfanyl)propan-2-yloxycarbonylamino] 2-methylprop-2-enoate (CID 175903234) is [1,3-bis(tritylsulfanyl)propan-2-yloxycarbonylamino] 2-methylprop-2-enoate.
What is the SMILES notation for [1,3-bis(tritylsulfanyl)propan-2-yloxycarbonylamino] 2-methylprop-2-enoate?
The canonical SMILES for [1,3-bis(tritylsulfanyl)propan-2-yloxycarbonylamino] 2-methylprop-2-enoate is C=C(C)C(=O)ONC(=O)OC(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)CSC(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of [1,3-bis(tritylsulfanyl)propan-2-yloxycarbonylamino] 2-methylprop-2-enoate?
The InChIKey is HZSZLOYKPMLKSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C46H41NO4S2/c1-35(2)43(48)51-47-44(49)50-42(33-52-45(36-21-9-3-10-22-36,37-23-11-4-12-24-37)38-25-13-5-14-26-38)34-53-46(39-27-15-6-16-28-39,40-29-17-7-18-30-40)41-31-19-8-20-32-41/h3-32,42H,1,33-34H2,2H3,(H,47,49).
What are the key properties of [1,3-bis(tritylsulfanyl)propan-2-yloxycarbonylamino] 2-methylprop-2-enoate?
[1,3-bis(tritylsulfanyl)propan-2-yloxycarbonylamino] 2-methylprop-2-enoate has a molecular weight of 735.97 g/mol, XLogP of 10.57, 14 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3-bis(tritylsulfanyl)propan-2-yloxycarbonylamino] 2-methylprop-2-enoate is sourced from PubChem (CID 175903234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).