About 3-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-2-hydroxybenzaldehyde
3-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-2-hydroxybenzaldehyde (PubChem CID 175903594) has the molecular formula C14H9FN2O2
and a molecular weight of 256.24 g/mol. Its IUPAC name is 3-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-2-hydroxybenzaldehyde.
Molecular Properties
| Compound Name | 3-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-2-hydroxybenzaldehyde |
| PubChem CID | 175903594 |
| Molecular Formula | C14H9FN2O2 |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 3-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-2-hydroxybenzaldehyde |
| SMILES | O=Cc1cccc(-c2cnc3ccc(F)cn23)c1O |
| InChI | InChI=1S/C14H9FN2O2/c15-10-4-5-13-16-6-12(17(13)7-10)11-3-1-2-9(8-18)14(11)19/h1-8,19H |
| InChIKey | TYGQNAPNAGDFNI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-2-hydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-2-hydroxybenzaldehyde?
The IUPAC name of 3-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-2-hydroxybenzaldehyde (CID 175903594) is 3-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-2-hydroxybenzaldehyde.
What is the SMILES notation for 3-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-2-hydroxybenzaldehyde?
The canonical SMILES for 3-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-2-hydroxybenzaldehyde is O=Cc1cccc(-c2cnc3ccc(F)cn23)c1O.
What is the InChIKey of 3-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-2-hydroxybenzaldehyde?
The InChIKey is TYGQNAPNAGDFNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9FN2O2/c15-10-4-5-13-16-6-12(17(13)7-10)11-3-1-2-9(8-18)14(11)19/h1-8,19H.
What are the key properties of 3-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-2-hydroxybenzaldehyde?
3-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-2-hydroxybenzaldehyde has a molecular weight of 256.24 g/mol, XLogP of 2.66, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-2-hydroxybenzaldehyde is sourced from PubChem (CID 175903594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).