About 2-[4-chloro-3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-2,6-naphthyridine
2-[4-chloro-3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-2,6-naphthyridine (PubChem CID 175903775) has the molecular formula C15H12ClF3N2
and a molecular weight of 312.72 g/mol. Its IUPAC name is 2-[4-chloro-3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-2,6-naphthyridine.
Molecular Properties
| Compound Name | 2-[4-chloro-3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-2,6-naphthyridine |
| PubChem CID | 175903775 |
| Molecular Formula | C15H12ClF3N2 |
| Molecular Weight | 312.72 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 2-[4-chloro-3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-2,6-naphthyridine |
| SMILES | FC(F)(F)c1cc(N2CCc3cnccc3C2)ccc1Cl |
| InChI | InChI=1S/C15H12ClF3N2/c16-14-2-1-12(7-13(14)15(17,18)19)21-6-4-10-8-20-5-3-11(10)9-21/h1-3,5,7-8H,4,6,9H2 |
| InChIKey | UHEBDHULLUJUOY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.72 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[4-chloro-3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-2,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-chloro-3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-2,6-naphthyridine?
The IUPAC name of 2-[4-chloro-3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-2,6-naphthyridine (CID 175903775) is 2-[4-chloro-3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-2,6-naphthyridine.
What is the SMILES notation for 2-[4-chloro-3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-2,6-naphthyridine?
The canonical SMILES for 2-[4-chloro-3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-2,6-naphthyridine is FC(F)(F)c1cc(N2CCc3cnccc3C2)ccc1Cl.
What is the InChIKey of 2-[4-chloro-3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-2,6-naphthyridine?
The InChIKey is UHEBDHULLUJUOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClF3N2/c16-14-2-1-12(7-13(14)15(17,18)19)21-6-4-10-8-20-5-3-11(10)9-21/h1-3,5,7-8H,4,6,9H2.
What are the key properties of 2-[4-chloro-3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-2,6-naphthyridine?
2-[4-chloro-3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-2,6-naphthyridine has a molecular weight of 312.72 g/mol, XLogP of 4.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-chloro-3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-2,6-naphthyridine is sourced from PubChem (CID 175903775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).