About 4,9-dihydropyrrolo[3,4-h][1,4]benzoxazine
4,9-dihydropyrrolo[3,4-h][1,4]benzoxazine (PubChem CID 175904431) has the molecular formula C10H8N2O
and a molecular weight of 172.19 g/mol. Its IUPAC name is 4,9-dihydropyrrolo[3,4-h][1,4]benzoxazine.
Molecular Properties
| Compound Name | 4,9-dihydropyrrolo[3,4-h][1,4]benzoxazine |
| PubChem CID | 175904431 |
| Molecular Formula | C10H8N2O |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 4,9-dihydropyrrolo[3,4-h][1,4]benzoxazine |
| SMILES | C1=COc2c(ccc3c2CN=C3)N1 |
| InChI | InChI=1S/C10H8N2O/c1-2-9-10(13-4-3-12-9)8-6-11-5-7(1)8/h1-5,12H,6H2 |
| InChIKey | QCHCEMYQMGVZFB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,9-dihydropyrrolo[3,4-h][1,4]benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,9-dihydropyrrolo[3,4-h][1,4]benzoxazine?
The IUPAC name of 4,9-dihydropyrrolo[3,4-h][1,4]benzoxazine (CID 175904431) is 4,9-dihydropyrrolo[3,4-h][1,4]benzoxazine.
What is the SMILES notation for 4,9-dihydropyrrolo[3,4-h][1,4]benzoxazine?
The canonical SMILES for 4,9-dihydropyrrolo[3,4-h][1,4]benzoxazine is C1=COc2c(ccc3c2CN=C3)N1.
What is the InChIKey of 4,9-dihydropyrrolo[3,4-h][1,4]benzoxazine?
The InChIKey is QCHCEMYQMGVZFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O/c1-2-9-10(13-4-3-12-9)8-6-11-5-7(1)8/h1-5,12H,6H2.
What are the key properties of 4,9-dihydropyrrolo[3,4-h][1,4]benzoxazine?
4,9-dihydropyrrolo[3,4-h][1,4]benzoxazine has a molecular weight of 172.19 g/mol, XLogP of 1.89, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,9-dihydropyrrolo[3,4-h][1,4]benzoxazine is sourced from PubChem (CID 175904431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).