About 5-benzyltriazecane-6,8-dione
5-benzyltriazecane-6,8-dione (PubChem CID 175905242) has the molecular formula C14H19N3O2
and a molecular weight of 261.32 g/mol. Its IUPAC name is 5-benzyltriazecane-6,8-dione.
Molecular Properties
| Compound Name | 5-benzyltriazecane-6,8-dione |
| PubChem CID | 175905242 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 5-benzyltriazecane-6,8-dione |
| SMILES | O=C1CCNNNCC(Cc2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C14H19N3O2/c18-13-6-7-15-17-16-10-12(14(19)9-13)8-11-4-2-1-3-5-11/h1-5,12,15-17H,6-10H2 |
| InChIKey | SZRYKXNMCQSABG-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-benzyltriazecane-6,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyltriazecane-6,8-dione?
The IUPAC name of 5-benzyltriazecane-6,8-dione (CID 175905242) is 5-benzyltriazecane-6,8-dione.
What is the SMILES notation for 5-benzyltriazecane-6,8-dione?
The canonical SMILES for 5-benzyltriazecane-6,8-dione is O=C1CCNNNCC(Cc2ccccc2)C(=O)C1.
What is the InChIKey of 5-benzyltriazecane-6,8-dione?
The InChIKey is SZRYKXNMCQSABG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O2/c18-13-6-7-15-17-16-10-12(14(19)9-13)8-11-4-2-1-3-5-11/h1-5,12,15-17H,6-10H2.
What are the key properties of 5-benzyltriazecane-6,8-dione?
5-benzyltriazecane-6,8-dione has a molecular weight of 261.32 g/mol, XLogP of 0.38, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyltriazecane-6,8-dione is sourced from PubChem (CID 175905242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).