C17H17BrN2O — CID 175905861
1-bromo-N-(furan-2-ylmethyl)-2,3,4,9-tetrahydrocarbazol-1-amine (PubChem CID 175905861) has the molecular formula C17H17BrN2O and a molecular weight of 345.24 g/mol. Its IUPAC name is 1-bromo-N-(furan-2-ylmethyl)-2,3,4,9-tetrahydrocarbazol-1-amine.
| Compound Name | 1-bromo-N-(furan-2-ylmethyl)-2,3,4,9-tetrahydrocarbazol-1-amine |
|---|---|
| PubChem CID | 175905861 |
| Molecular Formula | C17H17BrN2O |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 1-bromo-N-(furan-2-ylmethyl)-2,3,4,9-tetrahydrocarbazol-1-amine |
| SMILES | BrC1(NCc2ccco2)CCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C17H17BrN2O/c18-17(19-11-12-5-4-10-21-12)9-3-7-14-13-6-1-2-8-15(13)20-16(14)17/h1-2,4-6,8,10,19-20H,3,7,9,11H2 |
| InChIKey | CQRRALRTAVQTCF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 40.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|