About 2-trimethylsilylethyl 5-(hydroxymethyl)-2,3-dihydropyrrole-1-carboxylate
2-trimethylsilylethyl 5-(hydroxymethyl)-2,3-dihydropyrrole-1-carboxylate (PubChem CID 175906398) has the molecular formula C11H21NO3Si
and a molecular weight of 243.38 g/mol. Its IUPAC name is 2-trimethylsilylethyl 5-(hydroxymethyl)-2,3-dihydropyrrole-1-carboxylate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl 5-(hydroxymethyl)-2,3-dihydropyrrole-1-carboxylate |
| PubChem CID | 175906398 |
| Molecular Formula | C11H21NO3Si |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 2-trimethylsilylethyl 5-(hydroxymethyl)-2,3-dihydropyrrole-1-carboxylate |
| SMILES | C[Si](C)(C)CCOC(=O)N1CCC=C1CO |
| InChI | InChI=1S/C11H21NO3Si/c1-16(2,3)8-7-15-11(14)12-6-4-5-10(12)9-13/h5,13H,4,6-9H2,1-3H3 |
| InChIKey | NOMGECFNYRILCZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl 5-(hydroxymethyl)-2,3-dihydropyrrole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl 5-(hydroxymethyl)-2,3-dihydropyrrole-1-carboxylate?
The IUPAC name of 2-trimethylsilylethyl 5-(hydroxymethyl)-2,3-dihydropyrrole-1-carboxylate (CID 175906398) is 2-trimethylsilylethyl 5-(hydroxymethyl)-2,3-dihydropyrrole-1-carboxylate.
What is the SMILES notation for 2-trimethylsilylethyl 5-(hydroxymethyl)-2,3-dihydropyrrole-1-carboxylate?
The canonical SMILES for 2-trimethylsilylethyl 5-(hydroxymethyl)-2,3-dihydropyrrole-1-carboxylate is C[Si](C)(C)CCOC(=O)N1CCC=C1CO.
What is the InChIKey of 2-trimethylsilylethyl 5-(hydroxymethyl)-2,3-dihydropyrrole-1-carboxylate?
The InChIKey is NOMGECFNYRILCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3Si/c1-16(2,3)8-7-15-11(14)12-6-4-5-10(12)9-13/h5,13H,4,6-9H2,1-3H3.
What are the key properties of 2-trimethylsilylethyl 5-(hydroxymethyl)-2,3-dihydropyrrole-1-carboxylate?
2-trimethylsilylethyl 5-(hydroxymethyl)-2,3-dihydropyrrole-1-carboxylate has a molecular weight of 243.38 g/mol, XLogP of 2.04, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl 5-(hydroxymethyl)-2,3-dihydropyrrole-1-carboxylate is sourced from PubChem (CID 175906398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).