C12H12BBrIN2NaO2 — CID 175907618
CID 175907618 (PubChem CID 175907618) has the molecular formula C12H12BBrIN2NaO2 and a molecular weight of 456.85 g/mol.
| Compound Name | CID 175907618 |
|---|---|
| PubChem CID | 175907618 |
| Molecular Formula | C12H12BBrIN2NaO2 |
| Molecular Weight | 456.85 g/mol |
| Exact Mass | 455.91 |
| IUPAC Name | — |
| SMILES | CC(O)COc1cc(-n2cccn2)c(I)cc1Br.[B-].[Na+] |
| InChI | InChI=1S/C12H12BrIN2O2.B.Na/c1-8(17)7-18-12-6-11(10(14)5-9(12)13)16-4-2-3-15-16;;/h2-6,8,17H,7H2,1H3;;/q;-1;+1 |
| InChIKey | YPTJYXHUJIVQOM-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.85 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|