C8H24N4 — CID 175907731
azane;N,N-dimethyl-1-piperidin-4-ylmethanamine (PubChem CID 175907731) has the molecular formula C8H24N4 and a molecular weight of 176.31 g/mol. Its IUPAC name is azane;N,N-dimethyl-1-piperidin-4-ylmethanamine.
| Compound Name | azane;N,N-dimethyl-1-piperidin-4-ylmethanamine |
|---|---|
| PubChem CID | 175907731 |
| Molecular Formula | C8H24N4 |
| Molecular Weight | 176.31 g/mol |
| Exact Mass | 176.20 |
| IUPAC Name | azane;N,N-dimethyl-1-piperidin-4-ylmethanamine |
| SMILES | CN(C)CC1CCNCC1.N.N |
| InChI | InChI=1S/C8H18N2.2H3N/c1-10(2)7-8-3-5-9-6-4-8;;/h8-9H,3-7H2,1-2H3;2*1H3 |
| InChIKey | OARQNZBLCAIGIF-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 85.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |