About 2-benzylidene-3,3-dimethylpentanal
2-benzylidene-3,3-dimethylpentanal (PubChem CID 175908498) has the molecular formula C14H18O
and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-benzylidene-3,3-dimethylpentanal.
Molecular Properties
| Compound Name | 2-benzylidene-3,3-dimethylpentanal |
| PubChem CID | 175908498 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 2-benzylidene-3,3-dimethylpentanal |
| SMILES | CCC(C)(C)C(C=O)=Cc1ccccc1 |
| InChI | InChI=1S/C14H18O/c1-4-14(2,3)13(11-15)10-12-8-6-5-7-9-12/h5-11H,4H2,1-3H3 |
| InChIKey | KOCBAUSLNDZRQA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-benzylidene-3,3-dimethylpentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylidene-3,3-dimethylpentanal?
The IUPAC name of 2-benzylidene-3,3-dimethylpentanal (CID 175908498) is 2-benzylidene-3,3-dimethylpentanal.
What is the SMILES notation for 2-benzylidene-3,3-dimethylpentanal?
The canonical SMILES for 2-benzylidene-3,3-dimethylpentanal is CCC(C)(C)C(C=O)=Cc1ccccc1.
What is the InChIKey of 2-benzylidene-3,3-dimethylpentanal?
The InChIKey is KOCBAUSLNDZRQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O/c1-4-14(2,3)13(11-15)10-12-8-6-5-7-9-12/h5-11H,4H2,1-3H3.
What are the key properties of 2-benzylidene-3,3-dimethylpentanal?
2-benzylidene-3,3-dimethylpentanal has a molecular weight of 202.30 g/mol, XLogP of 3.71, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylidene-3,3-dimethylpentanal is sourced from PubChem (CID 175908498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).