C20H22N4O3 — CID 175908973
(2S,4R)-4-[5-(5-cyano-2-cyclopropyloxyphenyl)-2H-1,3-oxazol-3-yl]-2-(methoxymethyl)pyrrolidine-1-carbonitrile (PubChem CID 175908973) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is (2S,4R)-4-[5-(5-cyano-2-cyclopropyloxyphenyl)-2H-1,3-oxazol-3-yl]-2-(methoxymethyl)pyrrolidine-1-carbonitrile.
| Compound Name | (2S,4R)-4-[5-(5-cyano-2-cyclopropyloxyphenyl)-2H-1,3-oxazol-3-yl]-2-(methoxymethyl)pyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 175908973 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (2S,4R)-4-[5-(5-cyano-2-cyclopropyloxyphenyl)-2H-1,3-oxazol-3-yl]-2-(methoxymethyl)pyrrolidine-1-carbonitrile |
| SMILES | COC[C@@H]1C[C@@H](N2C=C(c3cc(C#N)ccc3OC3CC3)OC2)CN1C#N |
| InChI | InChI=1S/C20H22N4O3/c1-25-11-16-7-15(9-23(16)12-22)24-10-20(26-13-24)18-6-14(8-21)2-5-19(18)27-17-3-4-17/h2,5-6,10,15-17H,3-4,7,9,11,13H2,1H3/t15-,16+/m1/s1 |
| InChIKey | GNMHEICELPOTSN-CVEARBPZSA-N |
| XLogP | 2.26 |
| TPSA | 81.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|