C14H18N3O5P — CID 175909303
[5-[[(1S)-1-(4-cyanophenyl)ethyl]carbamoyl]pyrrolidin-3-yl] dihydrogen phosphate (PubChem CID 175909303) has the molecular formula C14H18N3O5P and a molecular weight of 339.29 g/mol. Its IUPAC name is [5-[[(1S)-1-(4-cyanophenyl)ethyl]carbamoyl]pyrrolidin-3-yl] dihydrogen phosphate.
| Compound Name | [5-[[(1S)-1-(4-cyanophenyl)ethyl]carbamoyl]pyrrolidin-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 175909303 |
| Molecular Formula | C14H18N3O5P |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | [5-[[(1S)-1-(4-cyanophenyl)ethyl]carbamoyl]pyrrolidin-3-yl] dihydrogen phosphate |
| SMILES | C[C@H](NC(=O)C1CC(OP(=O)(O)O)CN1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H18N3O5P/c1-9(11-4-2-10(7-15)3-5-11)17-14(18)13-6-12(8-16-13)22-23(19,20)21/h2-5,9,12-13,16H,6,8H2,1H3,(H,17,18)(H2,19,20,21)/t9-,12?,13?/m0/s1 |
| InChIKey | WBSWXVXNHYTTBA-ALXWSUNGSA-N |
| XLogP | 0.58 |
| TPSA | 131.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|