C14H14F3N3O2S — CID 175909578
N-methyl-N-[2-[[3-(trifluoromethyl)-4-pyridinyl]amino]phenyl]methanesulfonamide (PubChem CID 175909578) has the molecular formula C14H14F3N3O2S and a molecular weight of 345.35 g/mol. Its IUPAC name is N-methyl-N-[2-[[3-(trifluoromethyl)-4-pyridinyl]amino]phenyl]methanesulfonamide.
| Compound Name | N-methyl-N-[2-[[3-(trifluoromethyl)-4-pyridinyl]amino]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 175909578 |
| Molecular Formula | C14H14F3N3O2S |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | N-methyl-N-[2-[[3-(trifluoromethyl)-4-pyridinyl]amino]phenyl]methanesulfonamide |
| SMILES | CN(c1ccccc1Nc1ccncc1C(F)(F)F)S(C)(=O)=O |
| InChI | InChI=1S/C14H14F3N3O2S/c1-20(23(2,21)22)13-6-4-3-5-12(13)19-11-7-8-18-9-10(11)14(15,16)17/h3-9H,1-2H3,(H,18,19) |
| InChIKey | YVACOKXXDSVUBO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |