C24H23F9N6O6S — CID 175909623
bis(2,2,2-trifluoroacetic acid);2-[2-[[8-[[4-(trifluoromethyl)phenyl]sulfonylamino]quinolin-2-yl]methylamino]ethyl]guanidine (PubChem CID 175909623) has the molecular formula C24H23F9N6O6S and a molecular weight of 694.53 g/mol. Its IUPAC name is bis(2,2,2-trifluoroacetic acid);2-[2-[[8-[[4-(trifluoromethyl)phenyl]sulfonylamino]quinolin-2-yl]methylamino]ethyl]guanidine.
| Compound Name | bis(2,2,2-trifluoroacetic acid);2-[2-[[8-[[4-(trifluoromethyl)phenyl]sulfonylamino]quinolin-2-yl]methylamino]ethyl]guanidine |
|---|---|
| PubChem CID | 175909623 |
| Molecular Formula | C24H23F9N6O6S |
| Molecular Weight | 694.53 g/mol |
| Exact Mass | 694.13 |
| IUPAC Name | bis(2,2,2-trifluoroacetic acid);2-[2-[[8-[[4-(trifluoromethyl)phenyl]sulfonylamino]quinolin-2-yl]methylamino]ethyl]guanidine |
| SMILES | NC(N)=NCCNCc1ccc2cccc(NS(=O)(=O)c3ccc(C(F)(F)F)cc3)c2n1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H21F3N6O2S.2C2HF3O2/c21-20(22,23)14-5-8-16(9-6-14)32(30,31)29-17-3-1-2-13-4-7-15(28-18(13)17)12-26-10-11-27-19(24)25;2*3-2(4,5)1(6)7/h1-9,26,29H,10-12H2,(H4,24,25,27);2*(H,6,7) |
| InChIKey | YBJMZMUBYANJCS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 210.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|