C11H12FN3O2 — CID 175909632
4-(4-fluorophenyl)-5-oxopiperazine-2-carboxamide (PubChem CID 175909632) has the molecular formula C11H12FN3O2 and a molecular weight of 237.23 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-5-oxopiperazine-2-carboxamide.
| Compound Name | 4-(4-fluorophenyl)-5-oxopiperazine-2-carboxamide |
|---|---|
| PubChem CID | 175909632 |
| Molecular Formula | C11H12FN3O2 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 4-(4-fluorophenyl)-5-oxopiperazine-2-carboxamide |
| SMILES | NC(=O)C1CN(c2ccc(F)cc2)C(=O)CN1 |
| InChI | InChI=1S/C11H12FN3O2/c12-7-1-3-8(4-2-7)15-6-9(11(13)17)14-5-10(15)16/h1-4,9,14H,5-6H2,(H2,13,17) |
| InChIKey | TUEOSBZYSVMSOA-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |