About sodium;octyl benzenesulfonate;2-propan-2-ylbenzenesulfonate
sodium;octyl benzenesulfonate;2-propan-2-ylbenzenesulfonate (PubChem CID 175909833) has the molecular formula C23H33NaO6S2
and a molecular weight of 492.64 g/mol. Its IUPAC name is sodium;octyl benzenesulfonate;2-propan-2-ylbenzenesulfonate.
Molecular Properties
| Compound Name | sodium;octyl benzenesulfonate;2-propan-2-ylbenzenesulfonate |
| PubChem CID | 175909833 |
| Molecular Formula | C23H33NaO6S2 |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | sodium;octyl benzenesulfonate;2-propan-2-ylbenzenesulfonate |
| SMILES | CC(C)c1ccccc1S(=O)(=O)[O-].CCCCCCCCOS(=O)(=O)c1ccccc1.[Na+] |
| InChI | InChI=1S/C14H22O3S.C9H12O3S.Na/c1-2-3-4-5-6-10-13-17-18(15,16)14-11-8-7-9-12-14;1-7(2)8-5-3-4-6-9(8)13(10,11)12;/h7-9,11-12H,2-6,10,13H2,1H3;3-7H,1-2H3,(H,10,11,12);/q;;+1/p-1 |
| InChIKey | HVNMNYNSLDEFJW-UHFFFAOYSA-M |
| XLogP | 2.47 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;octyl benzenesulfonate;2-propan-2-ylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;octyl benzenesulfonate;2-propan-2-ylbenzenesulfonate?
The IUPAC name of sodium;octyl benzenesulfonate;2-propan-2-ylbenzenesulfonate (CID 175909833) is sodium;octyl benzenesulfonate;2-propan-2-ylbenzenesulfonate.
What is the SMILES notation for sodium;octyl benzenesulfonate;2-propan-2-ylbenzenesulfonate?
The canonical SMILES for sodium;octyl benzenesulfonate;2-propan-2-ylbenzenesulfonate is CC(C)c1ccccc1S(=O)(=O)[O-].CCCCCCCCOS(=O)(=O)c1ccccc1.[Na+].
What is the InChIKey of sodium;octyl benzenesulfonate;2-propan-2-ylbenzenesulfonate?
The InChIKey is HVNMNYNSLDEFJW-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H22O3S.C9H12O3S.Na/c1-2-3-4-5-6-10-13-17-18(15,16)14-11-8-7-9-12-14;1-7(2)8-5-3-4-6-9(8)13(10,11)12;/h7-9,11-12H,2-6,10,13H2,1H3;3-7H,1-2H3,(H,10,11,12);/q;;+1/p-1.
What are the key properties of sodium;octyl benzenesulfonate;2-propan-2-ylbenzenesulfonate?
sodium;octyl benzenesulfonate;2-propan-2-ylbenzenesulfonate has a molecular weight of 492.64 g/mol, XLogP of 2.47, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;octyl benzenesulfonate;2-propan-2-ylbenzenesulfonate is sourced from PubChem (CID 175909833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).