C25H40FNO4Si — CID 175910156
tert-butyl N-[(1R,2S,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorobenzoyl)cyclohexyl]-N-methylcarbamate (PubChem CID 175910156) has the molecular formula C25H40FNO4Si and a molecular weight of 465.68 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorobenzoyl)cyclohexyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(1R,2S,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorobenzoyl)cyclohexyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 175910156 |
| Molecular Formula | C25H40FNO4Si |
| Molecular Weight | 465.68 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | tert-butyl N-[(1R,2S,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorobenzoyl)cyclohexyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)[C@@H]1CC[C@@H](C(=O)c2ccc(F)cc2)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H40FNO4Si/c1-24(2,3)30-23(29)27(7)20-15-12-18(22(28)17-10-13-19(26)14-11-17)16-21(20)31-32(8,9)25(4,5)6/h10-11,13-14,18,20-21H,12,15-16H2,1-9H3/t18-,20-,21+/m1/s1 |
| InChIKey | DZMMNWDBZOWIJV-NRSPTQNISA-N |
| XLogP | 6.43 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.68 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|