C22H23F3N6O4 — CID 175910413
5-(3-cyclopropylphenyl)-N-[(3R,5S)-5-(triazol-1-ylmethyl)pyrrolidin-3-yl]-1,3-oxazole-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 175910413) has the molecular formula C22H23F3N6O4 and a molecular weight of 492.46 g/mol. Its IUPAC name is 5-(3-cyclopropylphenyl)-N-[(3R,5S)-5-(triazol-1-ylmethyl)pyrrolidin-3-yl]-1,3-oxazole-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 5-(3-cyclopropylphenyl)-N-[(3R,5S)-5-(triazol-1-ylmethyl)pyrrolidin-3-yl]-1,3-oxazole-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175910413 |
| Molecular Formula | C22H23F3N6O4 |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 5-(3-cyclopropylphenyl)-N-[(3R,5S)-5-(triazol-1-ylmethyl)pyrrolidin-3-yl]-1,3-oxazole-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(N[C@H]1CN[C@H](Cn2ccnn2)C1)c1ncc(-c2cccc(C3CC3)c2)o1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H22N6O2.C2HF3O2/c27-19(24-16-9-17(21-10-16)12-26-7-6-23-25-26)20-22-11-18(28-20)15-3-1-2-14(8-15)13-4-5-13;3-2(4,5)1(6)7/h1-3,6-8,11,13,16-17,21H,4-5,9-10,12H2,(H,24,27);(H,6,7)/t16-,17+;/m1./s1 |
| InChIKey | PBKREWXZFODCOP-PPPUBMIESA-N |
| XLogP | 2.60 |
| TPSA | 135.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |