C4H6O6Zn — CID 175911129
(2R,3S)-2,3-dihydroxybutanedioic acid;zinc (PubChem CID 175911129) has the molecular formula C4H6O6Zn and a molecular weight of 215.48 g/mol. Its IUPAC name is (2R,3S)-2,3-dihydroxybutanedioic acid;zinc.
| Compound Name | (2R,3S)-2,3-dihydroxybutanedioic acid;zinc |
|---|---|
| PubChem CID | 175911129 |
| Molecular Formula | C4H6O6Zn |
| Molecular Weight | 215.48 g/mol |
| Exact Mass | 213.95 |
| IUPAC Name | (2R,3S)-2,3-dihydroxybutanedioic acid;zinc |
| SMILES | O=C(O)[C@@H](O)[C@@H](O)C(=O)O.[Zn] |
| InChI | InChI=1S/C4H6O6.Zn/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/t1-,2+; |
| InChIKey | XJYXFGBRNDJLPC-NUGIMEKKSA-N |
| XLogP | -2.13 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.48 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|