About tert-butyl 4-[2-formyl-6-(methylcarbamoyl)-3-pyridinyl]piperazine-1-carboxylate;osmium
tert-butyl 4-[2-formyl-6-(methylcarbamoyl)-3-pyridinyl]piperazine-1-carboxylate;osmium (PubChem CID 175912511) has the molecular formula C17H24N4O4Os
and a molecular weight of 538.63 g/mol. Its IUPAC name is tert-butyl 4-[2-formyl-6-(methylcarbamoyl)-3-pyridinyl]piperazine-1-carboxylate;osmium.
Molecular Properties
| Compound Name | tert-butyl 4-[2-formyl-6-(methylcarbamoyl)-3-pyridinyl]piperazine-1-carboxylate;osmium |
| PubChem CID | 175912511 |
| Molecular Formula | C17H24N4O4Os |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | tert-butyl 4-[2-formyl-6-(methylcarbamoyl)-3-pyridinyl]piperazine-1-carboxylate;osmium |
| SMILES | CNC(=O)c1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)c(C=O)n1.[Os] |
| InChI | InChI=1S/C17H24N4O4.Os/c1-17(2,3)25-16(24)21-9-7-20(8-10-21)14-6-5-12(15(23)18-4)19-13(14)11-22;/h5-6,11H,7-10H2,1-4H3,(H,18,23); |
| InChIKey | NDKKZHYKDWOASG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[2-formyl-6-(methylcarbamoyl)-3-pyridinyl]piperazine-1-carboxylate;osmium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[2-formyl-6-(methylcarbamoyl)-3-pyridinyl]piperazine-1-carboxylate;osmium?
The IUPAC name of tert-butyl 4-[2-formyl-6-(methylcarbamoyl)-3-pyridinyl]piperazine-1-carboxylate;osmium (CID 175912511) is tert-butyl 4-[2-formyl-6-(methylcarbamoyl)-3-pyridinyl]piperazine-1-carboxylate;osmium.
What is the SMILES notation for tert-butyl 4-[2-formyl-6-(methylcarbamoyl)-3-pyridinyl]piperazine-1-carboxylate;osmium?
The canonical SMILES for tert-butyl 4-[2-formyl-6-(methylcarbamoyl)-3-pyridinyl]piperazine-1-carboxylate;osmium is CNC(=O)c1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)c(C=O)n1.[Os].
What is the InChIKey of tert-butyl 4-[2-formyl-6-(methylcarbamoyl)-3-pyridinyl]piperazine-1-carboxylate;osmium?
The InChIKey is NDKKZHYKDWOASG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4O4.Os/c1-17(2,3)25-16(24)21-9-7-20(8-10-21)14-6-5-12(15(23)18-4)19-13(14)11-22;/h5-6,11H,7-10H2,1-4H3,(H,18,23);.
What are the key properties of tert-butyl 4-[2-formyl-6-(methylcarbamoyl)-3-pyridinyl]piperazine-1-carboxylate;osmium?
tert-butyl 4-[2-formyl-6-(methylcarbamoyl)-3-pyridinyl]piperazine-1-carboxylate;osmium has a molecular weight of 538.63 g/mol, XLogP of 1.31, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[2-formyl-6-(methylcarbamoyl)-3-pyridinyl]piperazine-1-carboxylate;osmium is sourced from PubChem (CID 175912511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).