C11H21F3N4O6S2 — CID 175912587
2,3-bis(ethylamino)-3-(1H-imidazol-2-yl)propane-1-sulfonic acid;trifluoromethanesulfonic acid (PubChem CID 175912587) has the molecular formula C11H21F3N4O6S2 and a molecular weight of 426.44 g/mol. Its IUPAC name is 2,3-bis(ethylamino)-3-(1H-imidazol-2-yl)propane-1-sulfonic acid;trifluoromethanesulfonic acid.
| Compound Name | 2,3-bis(ethylamino)-3-(1H-imidazol-2-yl)propane-1-sulfonic acid;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 175912587 |
| Molecular Formula | C11H21F3N4O6S2 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 2,3-bis(ethylamino)-3-(1H-imidazol-2-yl)propane-1-sulfonic acid;trifluoromethanesulfonic acid |
| SMILES | CCNC(CS(=O)(=O)O)C(NCC)c1ncc[nH]1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C10H20N4O3S.CHF3O3S/c1-3-11-8(7-18(15,16)17)9(12-4-2)10-13-5-6-14-10;2-1(3,4)8(5,6)7/h5-6,8-9,11-12H,3-4,7H2,1-2H3,(H,13,14)(H,15,16,17);(H,5,6,7) |
| InChIKey | VZIPSSUQGCEQOQ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 161.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|