C12H12F8 — CID 175913012
1-(2,3,3,4,4,5,5,5-octafluoropentan-2-yl)bicyclo[2.2.1]hept-2-ene (PubChem CID 175913012) has the molecular formula C12H12F8 and a molecular weight of 308.21 g/mol. Its IUPAC name is 1-(2,3,3,4,4,5,5,5-octafluoropentan-2-yl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | 1-(2,3,3,4,4,5,5,5-octafluoropentan-2-yl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 175913012 |
| Molecular Formula | C12H12F8 |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 1-(2,3,3,4,4,5,5,5-octafluoropentan-2-yl)bicyclo[2.2.1]hept-2-ene |
| SMILES | CC(F)(C12C=CC(CC1)C2)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H12F8/c1-8(13,9-4-2-7(6-9)3-5-9)10(14,15)11(16,17)12(18,19)20/h2,4,7H,3,5-6H2,1H3 |
| InChIKey | QRJCIKIDCUMQCK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|