About 4-bromo-1-(4-bromophenyl)-2-ethynyl-3,5-diphenylbenzene
4-bromo-1-(4-bromophenyl)-2-ethynyl-3,5-diphenylbenzene (PubChem CID 175914549) has the molecular formula C26H16Br2
and a molecular weight of 488.22 g/mol. Its IUPAC name is 4-bromo-1-(4-bromophenyl)-2-ethynyl-3,5-diphenylbenzene.
Molecular Properties
| Compound Name | 4-bromo-1-(4-bromophenyl)-2-ethynyl-3,5-diphenylbenzene |
| PubChem CID | 175914549 |
| Molecular Formula | C26H16Br2 |
| Molecular Weight | 488.22 g/mol |
| Exact Mass | 485.96 |
| IUPAC Name | 4-bromo-1-(4-bromophenyl)-2-ethynyl-3,5-diphenylbenzene |
| SMILES | C#Cc1c(-c2ccc(Br)cc2)cc(-c2ccccc2)c(Br)c1-c1ccccc1 |
| InChI | InChI=1S/C26H16Br2/c1-2-22-23(19-13-15-21(27)16-14-19)17-24(18-9-5-3-6-10-18)26(28)25(22)20-11-7-4-8-12-20/h1,3-17H |
| InChIKey | NSFARRDIXPEAOB-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.22 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-1-(4-bromophenyl)-2-ethynyl-3,5-diphenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1-(4-bromophenyl)-2-ethynyl-3,5-diphenylbenzene?
The IUPAC name of 4-bromo-1-(4-bromophenyl)-2-ethynyl-3,5-diphenylbenzene (CID 175914549) is 4-bromo-1-(4-bromophenyl)-2-ethynyl-3,5-diphenylbenzene.
What is the SMILES notation for 4-bromo-1-(4-bromophenyl)-2-ethynyl-3,5-diphenylbenzene?
The canonical SMILES for 4-bromo-1-(4-bromophenyl)-2-ethynyl-3,5-diphenylbenzene is C#Cc1c(-c2ccc(Br)cc2)cc(-c2ccccc2)c(Br)c1-c1ccccc1.
What is the InChIKey of 4-bromo-1-(4-bromophenyl)-2-ethynyl-3,5-diphenylbenzene?
The InChIKey is NSFARRDIXPEAOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H16Br2/c1-2-22-23(19-13-15-21(27)16-14-19)17-24(18-9-5-3-6-10-18)26(28)25(22)20-11-7-4-8-12-20/h1,3-17H.
What are the key properties of 4-bromo-1-(4-bromophenyl)-2-ethynyl-3,5-diphenylbenzene?
4-bromo-1-(4-bromophenyl)-2-ethynyl-3,5-diphenylbenzene has a molecular weight of 488.22 g/mol, XLogP of 8.19, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-(4-bromophenyl)-2-ethynyl-3,5-diphenylbenzene is sourced from PubChem (CID 175914549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).