About 2-[(2R)-2,4-dimethyl-1-phenylpentan-2-yl]-8-fluoroquinoline
2-[(2R)-2,4-dimethyl-1-phenylpentan-2-yl]-8-fluoroquinoline (PubChem CID 175915159) has the molecular formula C22H24FN
and a molecular weight of 321.44 g/mol. Its IUPAC name is 2-[(2R)-2,4-dimethyl-1-phenylpentan-2-yl]-8-fluoroquinoline.
Molecular Properties
| Compound Name | 2-[(2R)-2,4-dimethyl-1-phenylpentan-2-yl]-8-fluoroquinoline |
| PubChem CID | 175915159 |
| Molecular Formula | C22H24FN |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 2-[(2R)-2,4-dimethyl-1-phenylpentan-2-yl]-8-fluoroquinoline |
| SMILES | CC(C)C[C@](C)(Cc1ccccc1)c1ccc2cccc(F)c2n1 |
| InChI | InChI=1S/C22H24FN/c1-16(2)14-22(3,15-17-8-5-4-6-9-17)20-13-12-18-10-7-11-19(23)21(18)24-20/h4-13,16H,14-15H2,1-3H3/t22-/m1/s1 |
| InChIKey | NJXQWNNAOBOKBH-JOCHJYFZSA-N |
| XLogP | 5.92 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(2R)-2,4-dimethyl-1-phenylpentan-2-yl]-8-fluoroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R)-2,4-dimethyl-1-phenylpentan-2-yl]-8-fluoroquinoline?
The IUPAC name of 2-[(2R)-2,4-dimethyl-1-phenylpentan-2-yl]-8-fluoroquinoline (CID 175915159) is 2-[(2R)-2,4-dimethyl-1-phenylpentan-2-yl]-8-fluoroquinoline.
What is the SMILES notation for 2-[(2R)-2,4-dimethyl-1-phenylpentan-2-yl]-8-fluoroquinoline?
The canonical SMILES for 2-[(2R)-2,4-dimethyl-1-phenylpentan-2-yl]-8-fluoroquinoline is CC(C)C[C@](C)(Cc1ccccc1)c1ccc2cccc(F)c2n1.
What is the InChIKey of 2-[(2R)-2,4-dimethyl-1-phenylpentan-2-yl]-8-fluoroquinoline?
The InChIKey is NJXQWNNAOBOKBH-JOCHJYFZSA-N. The full InChI is InChI=1S/C22H24FN/c1-16(2)14-22(3,15-17-8-5-4-6-9-17)20-13-12-18-10-7-11-19(23)21(18)24-20/h4-13,16H,14-15H2,1-3H3/t22-/m1/s1.
What are the key properties of 2-[(2R)-2,4-dimethyl-1-phenylpentan-2-yl]-8-fluoroquinoline?
2-[(2R)-2,4-dimethyl-1-phenylpentan-2-yl]-8-fluoroquinoline has a molecular weight of 321.44 g/mol, XLogP of 5.92, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R)-2,4-dimethyl-1-phenylpentan-2-yl]-8-fluoroquinoline is sourced from PubChem (CID 175915159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).