C14H18F3N5O3 — CID 175915180
5-(methylamino)-1-[(3S,5R)-1-prop-2-enoyl-5-(trifluoromethoxymethyl)pyrrolidin-3-yl]pyrazole-4-carboxamide (PubChem CID 175915180) has the molecular formula C14H18F3N5O3 and a molecular weight of 361.32 g/mol. Its IUPAC name is 5-(methylamino)-1-[(3S,5R)-1-prop-2-enoyl-5-(trifluoromethoxymethyl)pyrrolidin-3-yl]pyrazole-4-carboxamide.
| Compound Name | 5-(methylamino)-1-[(3S,5R)-1-prop-2-enoyl-5-(trifluoromethoxymethyl)pyrrolidin-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 175915180 |
| Molecular Formula | C14H18F3N5O3 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 5-(methylamino)-1-[(3S,5R)-1-prop-2-enoyl-5-(trifluoromethoxymethyl)pyrrolidin-3-yl]pyrazole-4-carboxamide |
| SMILES | C=CC(=O)N1C[C@@H](n2ncc(C(N)=O)c2NC)C[C@@H]1COC(F)(F)F |
| InChI | InChI=1S/C14H18F3N5O3/c1-3-11(23)21-6-8(4-9(21)7-25-14(15,16)17)22-13(19-2)10(5-20-22)12(18)24/h3,5,8-9,19H,1,4,6-7H2,2H3,(H2,18,24)/t8-,9+/m0/s1 |
| InChIKey | FLCRJHPDZSHBME-DTWKUNHWSA-N |
| XLogP | 0.89 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|