C27H38BN3O5 — CID 175915851
2-[8-[(3R)-morpholin-3-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-2-azabicyclo[2.2.2]octan-5-one (PubChem CID 175915851) has the molecular formula C27H38BN3O5 and a molecular weight of 495.43 g/mol. Its IUPAC name is 2-[8-[(3R)-morpholin-3-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-2-azabicyclo[2.2.2]octan-5-one.
| Compound Name | 2-[8-[(3R)-morpholin-3-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-2-azabicyclo[2.2.2]octan-5-one |
|---|---|
| PubChem CID | 175915851 |
| Molecular Formula | C27H38BN3O5 |
| Molecular Weight | 495.43 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | 2-[8-[(3R)-morpholin-3-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-2-azabicyclo[2.2.2]octan-5-one |
| SMILES | CC1(C)OB(c2cc3c(c([C@@H]4COCCN4)c2)CN(C(=O)N2CC4CCC2CC4=O)CC3)OC1(C)C |
| InChI | InChI=1S/C27H38BN3O5/c1-26(2)27(3,4)36-28(35-26)19-11-17-7-9-30(15-22(17)21(12-19)23-16-34-10-8-29-23)25(33)31-14-18-5-6-20(31)13-24(18)32/h11-12,18,20,23,29H,5-10,13-16H2,1-4H3/t18?,20?,23-/m0/s1 |
| InChIKey | DYTVWGORRNVEJB-PXLSRWGNSA-N |
| XLogP | 2.18 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|