C25H36F2N2O2 — CID 175916401
4-[4-[4-(dibutoxymethyl)piperidin-1-yl]-2,6-difluorophenyl]-2,5-dihydropyridine (PubChem CID 175916401) has the molecular formula C25H36F2N2O2 and a molecular weight of 434.57 g/mol. Its IUPAC name is 4-[4-[4-(dibutoxymethyl)piperidin-1-yl]-2,6-difluorophenyl]-2,5-dihydropyridine.
| Compound Name | 4-[4-[4-(dibutoxymethyl)piperidin-1-yl]-2,6-difluorophenyl]-2,5-dihydropyridine |
|---|---|
| PubChem CID | 175916401 |
| Molecular Formula | C25H36F2N2O2 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 4-[4-[4-(dibutoxymethyl)piperidin-1-yl]-2,6-difluorophenyl]-2,5-dihydropyridine |
| SMILES | CCCCOC(OCCCC)C1CCN(c2cc(F)c(C3=CCN=CC3)c(F)c2)CC1 |
| InChI | InChI=1S/C25H36F2N2O2/c1-3-5-15-30-25(31-16-6-4-2)20-9-13-29(14-10-20)21-17-22(26)24(23(27)18-21)19-7-11-28-12-8-19/h7,12,17-18,20,25H,3-6,8-11,13-16H2,1-2H3 |
| InChIKey | WBAARJRJTLGITE-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|