C9H13N3O2 — CID 175916787
5-deuterio-1-piperidin-4-ylpyrimidine-2,4-dione (PubChem CID 175916787) has the molecular formula C9H13N3O2 and a molecular weight of 196.23 g/mol. Its IUPAC name is 5-deuterio-1-piperidin-4-ylpyrimidine-2,4-dione.
| Compound Name | 5-deuterio-1-piperidin-4-ylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 175916787 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 5-deuterio-1-piperidin-4-ylpyrimidine-2,4-dione |
| SMILES | [2H]c1cn(C2CCNCC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H13N3O2/c13-8-3-6-12(9(14)11-8)7-1-4-10-5-2-7/h3,6-7,10H,1-2,4-5H2,(H,11,13,14)/i3D |
| InChIKey | UTGRWCCEJROVAT-WFVSFCRTSA-N |
| XLogP | -0.54 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |