About CID 175916855
CID 175916855 (PubChem CID 175916855) has the molecular formula C4H6NaO2
and a molecular weight of 109.08 g/mol.
Molecular Properties
| Compound Name | CID 175916855 |
| PubChem CID | 175916855 |
| Molecular Formula | C4H6NaO2 |
| Molecular Weight | 109.08 g/mol |
| Exact Mass | 109.03 |
| IUPAC Name | — |
| SMILES | CC#CC(O)O.[Na] |
| InChI | InChI=1S/C4H6O2.Na/c1-2-3-4(5)6;/h4-6H,1H3; |
| InChIKey | IBZLYZSWXWSBQP-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.08 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 175916855 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175916855?
The IUPAC name of CID 175916855 (CID 175916855) is not available.
What is the SMILES notation for CID 175916855?
The canonical SMILES for CID 175916855 is CC#CC(O)O.[Na].
What is the InChIKey of CID 175916855?
The InChIKey is IBZLYZSWXWSBQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.Na/c1-2-3-4(5)6;/h4-6H,1H3;.
What are the key properties of CID 175916855?
CID 175916855 has a molecular weight of 109.08 g/mol, XLogP of -1.06, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175916855 is sourced from PubChem (CID 175916855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).