About 3'-(1-fluorocyclopropyl)spiro[cyclopropane-1,4'-isoquinoline]-1'-one
3'-(1-fluorocyclopropyl)spiro[cyclopropane-1,4'-isoquinoline]-1'-one (PubChem CID 175917335) has the molecular formula C14H12FNO
and a molecular weight of 229.25 g/mol. Its IUPAC name is 3'-(1-fluorocyclopropyl)spiro[cyclopropane-1,4'-isoquinoline]-1'-one.
Molecular Properties
| Compound Name | 3'-(1-fluorocyclopropyl)spiro[cyclopropane-1,4'-isoquinoline]-1'-one |
| PubChem CID | 175917335 |
| Molecular Formula | C14H12FNO |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 3'-(1-fluorocyclopropyl)spiro[cyclopropane-1,4'-isoquinoline]-1'-one |
| SMILES | O=C1N=C(C2(F)CC2)C2(CC2)c2ccccc21 |
| InChI | InChI=1S/C14H12FNO/c15-14(7-8-14)12-13(5-6-13)10-4-2-1-3-9(10)11(17)16-12/h1-4H,5-8H2 |
| InChIKey | GRXDOVJUZXNIAU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3'-(1-fluorocyclopropyl)spiro[cyclopropane-1,4'-isoquinoline]-1'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-(1-fluorocyclopropyl)spiro[cyclopropane-1,4'-isoquinoline]-1'-one?
The IUPAC name of 3'-(1-fluorocyclopropyl)spiro[cyclopropane-1,4'-isoquinoline]-1'-one (CID 175917335) is 3'-(1-fluorocyclopropyl)spiro[cyclopropane-1,4'-isoquinoline]-1'-one.
What is the SMILES notation for 3'-(1-fluorocyclopropyl)spiro[cyclopropane-1,4'-isoquinoline]-1'-one?
The canonical SMILES for 3'-(1-fluorocyclopropyl)spiro[cyclopropane-1,4'-isoquinoline]-1'-one is O=C1N=C(C2(F)CC2)C2(CC2)c2ccccc21.
What is the InChIKey of 3'-(1-fluorocyclopropyl)spiro[cyclopropane-1,4'-isoquinoline]-1'-one?
The InChIKey is GRXDOVJUZXNIAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12FNO/c15-14(7-8-14)12-13(5-6-13)10-4-2-1-3-9(10)11(17)16-12/h1-4H,5-8H2.
What are the key properties of 3'-(1-fluorocyclopropyl)spiro[cyclopropane-1,4'-isoquinoline]-1'-one?
3'-(1-fluorocyclopropyl)spiro[cyclopropane-1,4'-isoquinoline]-1'-one has a molecular weight of 229.25 g/mol, XLogP of 2.82, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-(1-fluorocyclopropyl)spiro[cyclopropane-1,4'-isoquinoline]-1'-one is sourced from PubChem (CID 175917335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).