About 5-(2,2-difluoroethylamino)-6-methylcyclohexa-2,4-dien-1-one
5-(2,2-difluoroethylamino)-6-methylcyclohexa-2,4-dien-1-one (PubChem CID 175917871) has the molecular formula C9H11F2NO
and a molecular weight of 187.19 g/mol. Its IUPAC name is 5-(2,2-difluoroethylamino)-6-methylcyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 5-(2,2-difluoroethylamino)-6-methylcyclohexa-2,4-dien-1-one |
| PubChem CID | 175917871 |
| Molecular Formula | C9H11F2NO |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 5-(2,2-difluoroethylamino)-6-methylcyclohexa-2,4-dien-1-one |
| SMILES | CC1C(=O)C=CC=C1NCC(F)F |
| InChI | InChI=1S/C9H11F2NO/c1-6-7(12-5-9(10)11)3-2-4-8(6)13/h2-4,6,9,12H,5H2,1H3 |
| InChIKey | LOVWJELSUDJZKT-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2,2-difluoroethylamino)-6-methylcyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-difluoroethylamino)-6-methylcyclohexa-2,4-dien-1-one?
The IUPAC name of 5-(2,2-difluoroethylamino)-6-methylcyclohexa-2,4-dien-1-one (CID 175917871) is 5-(2,2-difluoroethylamino)-6-methylcyclohexa-2,4-dien-1-one.
What is the SMILES notation for 5-(2,2-difluoroethylamino)-6-methylcyclohexa-2,4-dien-1-one?
The canonical SMILES for 5-(2,2-difluoroethylamino)-6-methylcyclohexa-2,4-dien-1-one is CC1C(=O)C=CC=C1NCC(F)F.
What is the InChIKey of 5-(2,2-difluoroethylamino)-6-methylcyclohexa-2,4-dien-1-one?
The InChIKey is LOVWJELSUDJZKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F2NO/c1-6-7(12-5-9(10)11)3-2-4-8(6)13/h2-4,6,9,12H,5H2,1H3.
What are the key properties of 5-(2,2-difluoroethylamino)-6-methylcyclohexa-2,4-dien-1-one?
5-(2,2-difluoroethylamino)-6-methylcyclohexa-2,4-dien-1-one has a molecular weight of 187.19 g/mol, XLogP of 1.50, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-difluoroethylamino)-6-methylcyclohexa-2,4-dien-1-one is sourced from PubChem (CID 175917871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).