C18H16F2N2O2 — CID 175918450
N-[(3R,4S)-4-fluoro-1-(2-fluorobenzoyl)pyrrolidin-3-yl]benzamide (PubChem CID 175918450) has the molecular formula C18H16F2N2O2 and a molecular weight of 330.33 g/mol. Its IUPAC name is N-[(3R,4S)-4-fluoro-1-(2-fluorobenzoyl)pyrrolidin-3-yl]benzamide.
| Compound Name | N-[(3R,4S)-4-fluoro-1-(2-fluorobenzoyl)pyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 175918450 |
| Molecular Formula | C18H16F2N2O2 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-[(3R,4S)-4-fluoro-1-(2-fluorobenzoyl)pyrrolidin-3-yl]benzamide |
| SMILES | O=C(N[C@@H]1CN(C(=O)c2ccccc2F)C[C@@H]1F)c1ccccc1 |
| InChI | InChI=1S/C18H16F2N2O2/c19-14-9-5-4-8-13(14)18(24)22-10-15(20)16(11-22)21-17(23)12-6-2-1-3-7-12/h1-9,15-16H,10-11H2,(H,21,23)/t15-,16+/m0/s1 |
| InChIKey | OJTCXUJLJAIBPA-JKSUJKDBSA-N |
| XLogP | 2.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |