About iridium(3+);bis(3-phenyl-2H-pyridin-2-ide)
iridium(3+);bis(3-phenyl-2H-pyridin-2-ide) (PubChem CID 175918735) has the molecular formula C22H16IrN2+
and a molecular weight of 500.60 g/mol. Its IUPAC name is iridium(3+);bis(3-phenyl-2H-pyridin-2-ide).
Molecular Properties
| Compound Name | iridium(3+);bis(3-phenyl-2H-pyridin-2-ide) |
| PubChem CID | 175918735 |
| Molecular Formula | C22H16IrN2+ |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 501.09 |
| IUPAC Name | iridium(3+);bis(3-phenyl-2H-pyridin-2-ide) |
| SMILES | [Ir+3].[c-]1ncccc1-c1ccccc1.[c-]1ncccc1-c1ccccc1 |
| InChI | InChI=1S/2C11H8N.Ir/c2*1-2-5-10(6-3-1)11-7-4-8-12-9-11;/h2*1-8H;/q2*-1;+3 |
| InChIKey | VZYZIAFYJPSLGZ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium(3+);bis(3-phenyl-2H-pyridin-2-ide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium(3+);bis(3-phenyl-2H-pyridin-2-ide)?
The IUPAC name of iridium(3+);bis(3-phenyl-2H-pyridin-2-ide) (CID 175918735) is iridium(3+);bis(3-phenyl-2H-pyridin-2-ide).
What is the SMILES notation for iridium(3+);bis(3-phenyl-2H-pyridin-2-ide)?
The canonical SMILES for iridium(3+);bis(3-phenyl-2H-pyridin-2-ide) is [Ir+3].[c-]1ncccc1-c1ccccc1.[c-]1ncccc1-c1ccccc1.
What is the InChIKey of iridium(3+);bis(3-phenyl-2H-pyridin-2-ide)?
The InChIKey is VZYZIAFYJPSLGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H8N.Ir/c2*1-2-5-10(6-3-1)11-7-4-8-12-9-11;/h2*1-8H;/q2*-1;+3.
What are the key properties of iridium(3+);bis(3-phenyl-2H-pyridin-2-ide)?
iridium(3+);bis(3-phenyl-2H-pyridin-2-ide) has a molecular weight of 500.60 g/mol, XLogP of 5.10, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iridium(3+);bis(3-phenyl-2H-pyridin-2-ide) is sourced from PubChem (CID 175918735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).