C17H34N6O — CID 175919009
(2S)-2-amino-1-[4-[(4-piperazin-1-ylpiperazin-1-yl)methyl]piperidin-1-yl]propan-1-one (PubChem CID 175919009) has the molecular formula C17H34N6O and a molecular weight of 338.50 g/mol. Its IUPAC name is (2S)-2-amino-1-[4-[(4-piperazin-1-ylpiperazin-1-yl)methyl]piperidin-1-yl]propan-1-one.
| Compound Name | (2S)-2-amino-1-[4-[(4-piperazin-1-ylpiperazin-1-yl)methyl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 175919009 |
| Molecular Formula | C17H34N6O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.28 |
| IUPAC Name | (2S)-2-amino-1-[4-[(4-piperazin-1-ylpiperazin-1-yl)methyl]piperidin-1-yl]propan-1-one |
| SMILES | C[C@H](N)C(=O)N1CCC(CN2CCN(N3CCNCC3)CC2)CC1 |
| InChI | InChI=1S/C17H34N6O/c1-15(18)17(24)21-6-2-16(3-7-21)14-20-10-12-23(13-11-20)22-8-4-19-5-9-22/h15-16,19H,2-14,18H2,1H3/t15-/m0/s1 |
| InChIKey | GYENQENHQLEYHX-HNNXBMFYSA-N |
| XLogP | -0.99 |
| TPSA | 68.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |