C8H5BF4O2 — CID 175919061
2-(2,3,4,6-tetrafluorophenyl)-1,3,2-dioxaborolane (PubChem CID 175919061) has the molecular formula C8H5BF4O2 and a molecular weight of 219.93 g/mol. Its IUPAC name is 2-(2,3,4,6-tetrafluorophenyl)-1,3,2-dioxaborolane.
| Compound Name | 2-(2,3,4,6-tetrafluorophenyl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 175919061 |
| Molecular Formula | C8H5BF4O2 |
| Molecular Weight | 219.93 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 2-(2,3,4,6-tetrafluorophenyl)-1,3,2-dioxaborolane |
| SMILES | Fc1cc(F)c(B2OCCO2)c(F)c1F |
| InChI | InChI=1S/C8H5BF4O2/c10-4-3-5(11)7(12)8(13)6(4)9-14-1-2-15-9/h3H,1-2H2 |
| InChIKey | JFKXGTGOKPGMHA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.93 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|