About [3-methyl-2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] carbamate
[3-methyl-2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] carbamate (PubChem CID 175919799) has the molecular formula C12H10N4O5S
and a molecular weight of 322.30 g/mol. Its IUPAC name is [3-methyl-2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] carbamate.
Molecular Properties
| Compound Name | [3-methyl-2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] carbamate |
| PubChem CID | 175919799 |
| Molecular Formula | C12H10N4O5S |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | [3-methyl-2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] carbamate |
| SMILES | Cc1cccc(OC(N)=O)c1C(=O)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C12H10N4O5S/c1-6-3-2-4-7(21-11(13)18)9(6)10(17)15-12-14-5-8(22-12)16(19)20/h2-5H,1H3,(H2,13,18)(H,14,15,17) |
| InChIKey | KKFPNZDGLARBCH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 137.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-methyl-2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methyl-2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] carbamate?
The IUPAC name of [3-methyl-2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] carbamate (CID 175919799) is [3-methyl-2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] carbamate.
What is the SMILES notation for [3-methyl-2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] carbamate?
The canonical SMILES for [3-methyl-2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] carbamate is Cc1cccc(OC(N)=O)c1C(=O)Nc1ncc([N+](=O)[O-])s1.
What is the InChIKey of [3-methyl-2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] carbamate?
The InChIKey is KKFPNZDGLARBCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4O5S/c1-6-3-2-4-7(21-11(13)18)9(6)10(17)15-12-14-5-8(22-12)16(19)20/h2-5H,1H3,(H2,13,18)(H,14,15,17).
What are the key properties of [3-methyl-2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] carbamate?
[3-methyl-2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] carbamate has a molecular weight of 322.30 g/mol, XLogP of 2.07, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methyl-2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] carbamate is sourced from PubChem (CID 175919799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).