About 2-benzyl-5-bromospiro[3,4-dihydroisoquinoline-1,1'-cyclopropane]
2-benzyl-5-bromospiro[3,4-dihydroisoquinoline-1,1'-cyclopropane] (PubChem CID 175920048) has the molecular formula C18H18BrN
and a molecular weight of 328.25 g/mol. Its IUPAC name is 2-benzyl-5-bromospiro[3,4-dihydroisoquinoline-1,1'-cyclopropane].
Molecular Properties
| Compound Name | 2-benzyl-5-bromospiro[3,4-dihydroisoquinoline-1,1'-cyclopropane] |
| PubChem CID | 175920048 |
| Molecular Formula | C18H18BrN |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 2-benzyl-5-bromospiro[3,4-dihydroisoquinoline-1,1'-cyclopropane] |
| SMILES | Brc1cccc2c1CCN(Cc1ccccc1)C21CC1 |
| InChI | InChI=1S/C18H18BrN/c19-17-8-4-7-16-15(17)9-12-20(18(16)10-11-18)13-14-5-2-1-3-6-14/h1-8H,9-13H2 |
| InChIKey | SPOUPNNJIYPILB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-benzyl-5-bromospiro[3,4-dihydroisoquinoline-1,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-5-bromospiro[3,4-dihydroisoquinoline-1,1'-cyclopropane]?
The IUPAC name of 2-benzyl-5-bromospiro[3,4-dihydroisoquinoline-1,1'-cyclopropane] (CID 175920048) is 2-benzyl-5-bromospiro[3,4-dihydroisoquinoline-1,1'-cyclopropane].
What is the SMILES notation for 2-benzyl-5-bromospiro[3,4-dihydroisoquinoline-1,1'-cyclopropane]?
The canonical SMILES for 2-benzyl-5-bromospiro[3,4-dihydroisoquinoline-1,1'-cyclopropane] is Brc1cccc2c1CCN(Cc1ccccc1)C21CC1.
What is the InChIKey of 2-benzyl-5-bromospiro[3,4-dihydroisoquinoline-1,1'-cyclopropane]?
The InChIKey is SPOUPNNJIYPILB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18BrN/c19-17-8-4-7-16-15(17)9-12-20(18(16)10-11-18)13-14-5-2-1-3-6-14/h1-8H,9-13H2.
What are the key properties of 2-benzyl-5-bromospiro[3,4-dihydroisoquinoline-1,1'-cyclopropane]?
2-benzyl-5-bromospiro[3,4-dihydroisoquinoline-1,1'-cyclopropane] has a molecular weight of 328.25 g/mol, XLogP of 4.50, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-5-bromospiro[3,4-dihydroisoquinoline-1,1'-cyclopropane] is sourced from PubChem (CID 175920048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).